tierraboyce1999 tierraboyce1999

03-11-2018
History

contestada

This military leader stopped the Union troops at Bull Run and pushed them back in a counter attack.

Respuesta :

midnightweirdo midnightweirdo

03-11-2018

I'm pretty sure it was Thomas "StoneWall" Jackson.

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Write the three smallest integers, so that each of them is greater than… -6

Find f(a-2) when f(x)= 2x^2 +3x

A static charge is developed in a substance _____. As the substance acquires loose protons due to friction As the substance loses protons due to friction As th

which is a key difference between a theme and a central idea

what do you predict will happen to the sudd if water is diverted to the canal

How do scientists know about the liquid outer core?

Limited searches conducted in accordance with constitutional guidelines serve society's needs while:

what is a substance that can not be broken down into any other substance by either chemical or physical means

A static charge is developed in a substance _____. As the substance acquires loose protons due to friction As the substance loses protons due to friction As th